CAS 454-15-9 appears in our catalog under these names: 2-(Bromomethyl)-1-fluoro-4-nitrobenzene, 98%, 2–(Bromomethyl)–1–fluoro–4–nitrobenzene, 2-Fluoro-5-nitrobenzyl bromide, 98%. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 1g, 25g, 100g, 5g, 10g, 250mg.
2-(bromomethyl)-1-fluoro-4-nitrobenzene (CAS 454-15-9) is a chemical compound with the molecular formula C7H5BrFNO2 and a molecular weight of 234.02 g/mol. IUPAC name: 2-(bromomethyl)-1-fluoro-4-nitrobenzene. InChIKey: KQAKOKGCKNKARC-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO2 |
|---|---|
| Molecular weight | 234.02 g/mol |
| IUPAC name | 2-(bromomethyl)-1-fluoro-4-nitrobenzene |
| InChIKey | KQAKOKGCKNKARC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])CBr)F |
Computed by PubChem (NCBI)