CAS 377780-72-8 appears in our catalog under these names: 2-Bromomethylphenylboronic Acid Pinacol Ester, >95% (HPLC), 2–Bromomethylphenylboronic acid pinacol ester, 2-(Bromomethyl)benzeneboronic acid pinacol ester, 98% , 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl Bromide, >98.0%(GC)(T), 2-BROMOMETHYLPHENYLBORONIC ACID PINACOL&. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Sigma-Aldrich. Available pack sizes: 5g, 25g, 1g, 250mg, 10g, 100g.
2-[2-(bromomethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 377780-72-8) is a chemical compound with the molecular formula C13H18BBrO2 and a molecular weight of 297.00 g/mol. IUPAC name: 2-[2-(bromomethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ROIXSNLOYHDYBP-UHFFFAOYSA-N.
| Molecular formula | C13H18BBrO2 |
|---|---|
| Molecular weight | 297.00 g/mol |
| IUPAC name | 2-[2-(bromomethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ROIXSNLOYHDYBP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2CBr |
Computed by PubChem (NCBI)