CAS 2057523-47-2 appears in our catalog under these names: 2-(3-Bromo-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 3-Bromo-2-methylphenylboronic acid pinacol ester, 95%, 3-Bromo-2-methylphenylboronic acid pinacol ester, 98%, 98%. Offered by: Fluorochem, Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 10g, 100mg.
2-(3-bromo-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2057523-47-2) is a chemical compound with the molecular formula C13H18BBrO2 and a molecular weight of 297.00 g/mol. IUPAC name: 2-(3-bromo-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: QBKJTENBXNNKBN-UHFFFAOYSA-N.
| Molecular formula | C13H18BBrO2 |
|---|---|
| Molecular weight | 297.00 g/mol |
| IUPAC name | 2-(3-bromo-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | QBKJTENBXNNKBN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)Br)C |
Computed by PubChem (NCBI)