Products 1379610-54-4
CAS 1379610-54-4 is the registry number for 2-(3-bromobenzyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
2-[(3-bromophenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1379610-54-4) is a chemical compound with the molecular formula C13H18BBrO2 and a molecular weight of 297.00 g/mol. IUPAC name: 2-[(3-bromophenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: PCLIZGYGJMLGID-UHFFFAOYSA-N.
| Molecular formula | C13H18BBrO2 |
|---|---|
| Molecular weight | 297.00 g/mol |
| IUPAC name | 2-[(3-bromophenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | PCLIZGYGJMLGID-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)