CAS 138500-85-3 appears in our catalog under these names: 4-Bromomethylphenylboronic acid, pinacol ester, 95%, 4–Bromomethylphenylboronic acid pinacol ester, 4-(Bromomethyl)benzeneboronic acid pinacol ester, 95% , 4-(Bromomethyl)benzeneboronic acid pinacol ester, 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl Bromide, >98.0%(GC)(T). Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 5g, 25g, 100g, 1g, 10g, 500g, 1000g.
2-[4-(bromomethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 138500-85-3) is a chemical compound with the molecular formula C13H18BBrO2 and a molecular weight of 297.00 g/mol. IUPAC name: 2-[4-(bromomethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: CBUOGMOTDGNEAW-UHFFFAOYSA-N.
| Molecular formula | C13H18BBrO2 |
|---|---|
| Molecular weight | 297.00 g/mol |
| IUPAC name | 2-[4-(bromomethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | CBUOGMOTDGNEAW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CBr |
Computed by PubChem (NCBI)