2-(Carboxymethyl)-4-fluorobenzoic acid, 96%
cas: 500779-09-9 — see every product listed under this CAS number, including other names
2-(Carboxymethyl)-4-fluorobenzoic acid, 96% (CAS 500779-09-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F340233-1G |
| cas | 500779-09-9 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 346.77 Pln | |
| Fluorochem | 10g | 440.49 Pln | |
| Fluorochem | 25g | 914.28 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
2-(carboxymethyl)-4-fluorobenzoic acid (CAS 500779-09-9) is a chemical compound with the molecular formula C9H7FO4 and a molecular weight of 198.15 g/mol. IUPAC name: 2-(carboxymethyl)-4-fluorobenzoic acid. InChIKey: NJRYCMRYNLWLED-UHFFFAOYSA-N.
| Molecular formula | C9H7FO4 |
|---|---|
| Molecular weight | 198.15 g/mol |
| IUPAC name | 2-(carboxymethyl)-4-fluorobenzoic acid |
| InChIKey | NJRYCMRYNLWLED-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)