Products 2151858-37-4

CAS 2151858-37-4 is the registry number for 3-Fluoro-5-methylphthalic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-fluoro-5-methylphthalic acid (CAS 2151858-37-4) is a chemical compound with the molecular formula C9H7FO4 and a molecular weight of 198.15 g/mol. IUPAC name: 3-fluoro-5-methylphthalic acid. InChIKey: XSHUZKORLDFEQZ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7FO4
Molecular weight198.15 g/mol
IUPAC name3-fluoro-5-methylphthalic acid
InChIKeyXSHUZKORLDFEQZ-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1)F)C(=O)O)C(=O)O

Computed by PubChem (NCBI)