CAS 583880-95-9 appears in our catalog under these names: 2–(Carboxymethyl)–5–fluorobenzoic acid, 2-(Carboxymethyl)-5-fluorobenzoic acid, 97%, 97%, 2-(CARBOXYMETHYL)-5-FLUOROBENZOIC ACID, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g.
2-(carboxymethyl)-5-fluorobenzoic acid (CAS 583880-95-9) is a chemical compound with the molecular formula C9H7FO4 and a molecular weight of 198.15 g/mol. IUPAC name: 2-(carboxymethyl)-5-fluorobenzoic acid. InChIKey: FXXMBGNOEIFPTJ-UHFFFAOYSA-N.
| Molecular formula | C9H7FO4 |
|---|---|
| Molecular weight | 198.15 g/mol |
| IUPAC name | 2-(carboxymethyl)-5-fluorobenzoic acid |
| InChIKey | FXXMBGNOEIFPTJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(=O)O)CC(=O)O |
Computed by PubChem (NCBI)