cas: 142577-03-5 — see every product listed under this CAS number, including other names
2-(Chloromethyl)-4-isopropyl-6-methoxybenzo(d)isothiazol-3(2H)-one 1,1-dioxide, 97% (CAS 142577-03-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A386809-1g |
| cas | 142577-03-5 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 23597.14 Pln | |
| AmBeed | 250mg | 9463.93 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(chloromethyl)-6-methoxy-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one (CAS 142577-03-5) is a chemical compound with the molecular formula C12H14ClNO4S and a molecular weight of 303.76 g/mol. IUPAC name: 2-(chloromethyl)-6-methoxy-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one. InChIKey: IAVWIJNTOZKJNL-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO4S |
|---|---|
| Molecular weight | 303.76 g/mol |
| IUPAC name | 2-(chloromethyl)-6-methoxy-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one |
| InChIKey | IAVWIJNTOZKJNL-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C2C(=CC(=C1)OC)S(=O)(=O)N(C2=O)CCl |
Computed by PubChem (NCBI)