CAS 321970-56-3 appears in our catalog under these names: 1-(4-Chloro-benzenesulfonyl)-piperidine-3-carboxylic acid, 1-[(4-Chlorophenyl)sulfonyl]piperidine-3-carboxylic acid, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 0,5g, 5g, 1g, 250mg, 10g.
1-(4-chlorophenyl)sulfonylpiperidine-3-carboxylic acid (CAS 321970-56-3) is a chemical compound with the molecular formula C12H14ClNO4S and a molecular weight of 303.76 g/mol. IUPAC name: 1-(4-chlorophenyl)sulfonylpiperidine-3-carboxylic acid. InChIKey: DZFXLKMJEOGJLV-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO4S |
|---|---|
| Molecular weight | 303.76 g/mol |
| IUPAC name | 1-(4-chlorophenyl)sulfonylpiperidine-3-carboxylic acid |
| InChIKey | DZFXLKMJEOGJLV-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)S(=O)(=O)C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)