Products 59210-74-1

CAS 59210-74-1 is the registry number for 4-Chloro-3-(piperidine-1-sulfonyl)-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

4-chloro-3-piperidin-1-ylsulfonylbenzoic acid (CAS 59210-74-1) is a chemical compound with the molecular formula C12H14ClNO4S and a molecular weight of 303.76 g/mol. IUPAC name: 4-chloro-3-piperidin-1-ylsulfonylbenzoic acid. InChIKey: FCNJMGGLUGSOGL-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14ClNO4S
Molecular weight303.76 g/mol
IUPAC name4-chloro-3-piperidin-1-ylsulfonylbenzoic acid
InChIKeyFCNJMGGLUGSOGL-UHFFFAOYSA-N
SMILESC1CCN(CC1)S(=O)(=O)C2=C(C=CC(=C2)C(=O)O)Cl

Computed by PubChem (NCBI)