CAS 1251071-16-5 is the registry number for (S)-Benzyl 3-(chlorosulfonyl)pyrrolidine-1-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
Benzyl (3S)-3-chlorosulfonylpyrrolidine-1-carboxylate (CAS 1251071-16-5) is a chemical compound with the molecular formula C12H14ClNO4S and a molecular weight of 303.76 g/mol. IUPAC name: benzyl (3S)-3-chlorosulfonylpyrrolidine-1-carboxylate. InChIKey: KGTKAEIBOSEJKH-NSHDSACASA-N.
| Molecular formula | C12H14ClNO4S |
|---|---|
| Molecular weight | 303.76 g/mol |
| IUPAC name | benzyl (3S)-3-chlorosulfonylpyrrolidine-1-carboxylate |
| InChIKey | KGTKAEIBOSEJKH-NSHDSACASA-N |
| SMILES | C1CN(C[C@H]1S(=O)(=O)Cl)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)