cas: 143708-33-2 — see every product listed under this CAS number, including other names
2-(Chloromethyl)-6-methylbenzoxazole, 95-<97% (CAS 143708-33-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC787-95-97-10g |
| cas | 143708-33-2 |
| size | 10g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 10g | 4569.84 Pln | |
| Hoffman Fine Chemicals | 25g | 8831.68 Pln | |
| Hoffman Fine Chemicals | 50g | 13948.44 Pln | |
| Hoffman Fine Chemicals | 100g | 22133.98 Pln | |
| Hoffman Fine Chemicals | 200g | 37414.08 Pln | |
| Hoffman Fine Chemicals | 300g | 47615.70 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
2-(chloromethyl)-6-methyl-1,3-benzoxazole (CAS 143708-33-2) is a chemical compound with the molecular formula C9H8ClNO and a molecular weight of 181.62 g/mol. IUPAC name: 2-(chloromethyl)-6-methyl-1,3-benzoxazole. InChIKey: XHGXJTDZCATPBF-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | 2-(chloromethyl)-6-methyl-1,3-benzoxazole |
| InChIKey | XHGXJTDZCATPBF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(O2)CCl |
Computed by PubChem (NCBI)