Products 1217110-69-4

CAS 1217110-69-4 is the registry number for Quinolin-3-ol hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

Quinolin-3-ol;hydrochloride (CAS 1217110-69-4) is a chemical compound with the molecular formula C9H8ClNO and a molecular weight of 181.62 g/mol. IUPAC name: quinolin-3-ol;hydrochloride. InChIKey: BOHDMKHEQAMOKO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8ClNO
Molecular weight181.62 g/mol
IUPAC namequinolin-3-ol;hydrochloride
InChIKeyBOHDMKHEQAMOKO-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C=C(C=N2)O.Cl

Computed by PubChem (NCBI)