CAS 15365-53-4 is the registry number for Isoquinolin-4-ol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Isoquinolin-4-ol;hydrochloride (CAS 15365-53-4) is a chemical compound with the molecular formula C9H8ClNO and a molecular weight of 181.62 g/mol. IUPAC name: isoquinolin-4-ol;hydrochloride. InChIKey: NZNGQIWJAYMQKL-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | isoquinolin-4-ol;hydrochloride |
| InChIKey | NZNGQIWJAYMQKL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=NC=C2O.Cl |
Computed by PubChem (NCBI)