Products 41014-44-2
CAS 41014-44-2 appears in our catalog under these names: 2-(Chloromethyl)-5-methyl-1,3-benzoxazole, 98%, 2-(Chloromethyl)-5-methylbenzo(d)oxazole, 98%, 2-(Chloromethyl)-5-methylbenzo[d]oxazole 98%, 2-(Chloromethyl)-5-methyl-1,3-benzoxazole, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 25g, 5g, 250mg.
2-(chloromethyl)-5-methyl-1,3-benzoxazole (CAS 41014-44-2) is a chemical compound with the molecular formula C9H8ClNO and a molecular weight of 181.62 g/mol. IUPAC name: 2-(chloromethyl)-5-methyl-1,3-benzoxazole. InChIKey: HLMSMIKJAZQYJS-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | 2-(chloromethyl)-5-methyl-1,3-benzoxazole |
| InChIKey | HLMSMIKJAZQYJS-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)OC(=N2)CCl |
Computed by PubChem (NCBI)