CAS 1236076-70-2 is the registry number for Bi(cyclopropane)-1-boronic acid pinacol ester. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(1-cyclopropylcyclopropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1236076-70-2) is a chemical compound with the molecular formula C12H21BO2 and a molecular weight of 208.11 g/mol. IUPAC name: 2-(1-cyclopropylcyclopropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: XIVZDSUKXDMVQH-UHFFFAOYSA-N.
| Molecular formula | C12H21BO2 |
|---|---|
| Molecular weight | 208.11 g/mol |
| IUPAC name | 2-(1-cyclopropylcyclopropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | XIVZDSUKXDMVQH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2(CC2)C3CC3 |
Computed by PubChem (NCBI)