CAS 2609867-47-0 is the registry number for 2-(Bicyclo(2.1.1)hexan-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: AmBeed. Available pack sizes: 250mg.
2-(1-bicyclo[2.1.1]hexanyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2609867-47-0) is a chemical compound with the molecular formula C12H21BO2 and a molecular weight of 208.11 g/mol. IUPAC name: 2-(1-bicyclo[2.1.1]hexanyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: DPAAIXJDYZKDCC-UHFFFAOYSA-N.
| Molecular formula | C12H21BO2 |
|---|---|
| Molecular weight | 208.11 g/mol |
| IUPAC name | 2-(1-bicyclo[2.1.1]hexanyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | DPAAIXJDYZKDCC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C23CCC(C2)C3 |
Computed by PubChem (NCBI)