cas: 1432491-43-4 — see every product listed under this CAS number, including other names
2-(Cyclopropylethynyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 95% (CAS 1432491-43-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HWUB-100mg |
| cas | 1432491-43-4 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 256.40 Pln | |
| Chemat | 250mg | 386.00 Pln | |
| Chemat | 1g | 1005.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(2-cyclopropylethynyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1432491-43-4) is a chemical compound with the molecular formula C11H17BO2 and a molecular weight of 192.06 g/mol. IUPAC name: 2-(2-cyclopropylethynyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: MCMLWIQRCZRVNH-UHFFFAOYSA-N.
| Molecular formula | C11H17BO2 |
|---|---|
| Molecular weight | 192.06 g/mol |
| IUPAC name | 2-(2-cyclopropylethynyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | MCMLWIQRCZRVNH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C#CC2CC2 |
Computed by PubChem (NCBI)