cas: 943-04-4 — see every product listed under this CAS number, including other names
2-(Dimethylamino)-1,3-benzothiazol-6-ol, 98% (CAS 943-04-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F494512-100MG |
| cas | 943-04-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 846.59 Pln | |
| Fluorochem | 250mg | 1263.11 Pln | |
| Fluorochem | 500mg | 2434.58 Pln | |
| Fluorochem | 1g | 3580.01 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-(dimethylamino)-1,3-benzothiazol-6-ol (CAS 943-04-4) is a chemical compound with the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. IUPAC name: 2-(dimethylamino)-1,3-benzothiazol-6-ol. InChIKey: PTSXJPLARKXKFV-UHFFFAOYSA-N.
| Molecular formula | C9H10N2OS |
|---|---|
| Molecular weight | 194.26 g/mol |
| IUPAC name | 2-(dimethylamino)-1,3-benzothiazol-6-ol |
| InChIKey | PTSXJPLARKXKFV-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC2=C(S1)C=C(C=C2)O |
Computed by PubChem (NCBI)