cas: 632325-51-0 — see every product listed under this CAS number, including other names
2-(Ethoxycarbonyl)thiophen-3-ylboronic acid (CAS 632325-51-0) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627299-1G |
| cas | 632325-51-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3278.03 Pln |
| delivery time | 3-4 weeks |
|---|
(2-ethoxycarbonylthiophen-3-yl)boronic acid (CAS 632325-51-0) is a chemical compound with the molecular formula C7H9BO4S and a molecular weight of 200.02 g/mol. IUPAC name: (2-ethoxycarbonylthiophen-3-yl)boronic acid. InChIKey: AZLKJXPIJBJJFG-UHFFFAOYSA-N.
| Molecular formula | C7H9BO4S |
|---|---|
| Molecular weight | 200.02 g/mol |
| IUPAC name | (2-ethoxycarbonylthiophen-3-yl)boronic acid |
| InChIKey | AZLKJXPIJBJJFG-UHFFFAOYSA-N |
| SMILES | B(C1=C(SC=C1)C(=O)OCC)(O)O |
Computed by PubChem (NCBI)