cas: 208643-03-2 — see every product listed under this CAS number, including other names
2-(Morpholinosulfonyl)aniline, 95%, 95% (CAS 208643-03-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113JT1-250mg |
| cas | 208643-03-2 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 256.40 Pln | |
| Chemat | 5g | 1062.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-morpholin-4-ylsulfonylaniline (CAS 208643-03-2) is a chemical compound with the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. IUPAC name: 2-morpholin-4-ylsulfonylaniline. InChIKey: WLPZGLWVUUJJTB-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O3S |
|---|---|
| Molecular weight | 242.30 g/mol |
| IUPAC name | 2-morpholin-4-ylsulfonylaniline |
| InChIKey | WLPZGLWVUUJJTB-UHFFFAOYSA-N |
| SMILES | C1COCCN1S(=O)(=O)C2=CC=CC=C2N |
Computed by PubChem (NCBI)