CAS 350996-95-1 is the registry number for 2-Amino-5-dimethylcarbamoyl-4-methylthiophene-3-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
Methyl 2-amino-5-(dimethylcarbamoyl)-4-methylthiophene-3-carboxylate (CAS 350996-95-1) is a chemical compound with the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. IUPAC name: methyl 2-amino-5-(dimethylcarbamoyl)-4-methylthiophene-3-carboxylate. InChIKey: WDWQGNNCVALKRI-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O3S |
|---|---|
| Molecular weight | 242.30 g/mol |
| IUPAC name | methyl 2-amino-5-(dimethylcarbamoyl)-4-methylthiophene-3-carboxylate |
| InChIKey | WDWQGNNCVALKRI-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1C(=O)OC)N)C(=O)N(C)C |
Computed by PubChem (NCBI)