Products 350996-95-1

CAS 350996-95-1 is the registry number for 2-Amino-5-dimethylcarbamoyl-4-methylthiophene-3-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 2-amino-5-(dimethylcarbamoyl)-4-methylthiophene-3-carboxylate (CAS 350996-95-1) is a chemical compound with the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. IUPAC name: methyl 2-amino-5-(dimethylcarbamoyl)-4-methylthiophene-3-carboxylate. InChIKey: WDWQGNNCVALKRI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14N2O3S
Molecular weight242.30 g/mol
IUPAC namemethyl 2-amino-5-(dimethylcarbamoyl)-4-methylthiophene-3-carboxylate
InChIKeyWDWQGNNCVALKRI-UHFFFAOYSA-N
SMILESCC1=C(SC(=C1C(=O)OC)N)C(=O)N(C)C

Computed by PubChem (NCBI)