CAS 927963-79-9 appears in our catalog under these names: 2-(3-Amino-4-methoxyphenyl)-1lambda(6),2-thiazolidine-1,1-dione, 95%, 5-(1,1-Dioxidoisothiazolidin-2-yl)-2-methoxyaniline, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methoxyaniline (CAS 927963-79-9) is a chemical compound with the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. IUPAC name: 5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methoxyaniline. InChIKey: LEYJWOBUSQMOSG-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O3S |
|---|---|
| Molecular weight | 242.30 g/mol |
| IUPAC name | 5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methoxyaniline |
| InChIKey | LEYJWOBUSQMOSG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)N2CCCS2(=O)=O)N |
Computed by PubChem (NCBI)