Products 1072806-66-6

CAS 1072806-66-6 is the registry number for 2-(Aminomethyl)-1h-indole methanesulphonate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

1H-indol-2-ylmethanamine;methanesulfonic acid (CAS 1072806-66-6) is a chemical compound with the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. IUPAC name: 1H-indol-2-ylmethanamine;methanesulfonic acid. InChIKey: JTFXLRDQYSVMIU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14N2O3S
Molecular weight242.30 g/mol
IUPAC name1H-indol-2-ylmethanamine;methanesulfonic acid
InChIKeyJTFXLRDQYSVMIU-UHFFFAOYSA-N
SMILESCS(=O)(=O)O.C1=CC=C2C(=C1)C=C(N2)CN

Computed by PubChem (NCBI)