CAS 1072806-66-6 is the registry number for 2-(Aminomethyl)-1h-indole methanesulphonate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
1H-indol-2-ylmethanamine;methanesulfonic acid (CAS 1072806-66-6) is a chemical compound with the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. IUPAC name: 1H-indol-2-ylmethanamine;methanesulfonic acid. InChIKey: JTFXLRDQYSVMIU-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O3S |
|---|---|
| Molecular weight | 242.30 g/mol |
| IUPAC name | 1H-indol-2-ylmethanamine;methanesulfonic acid |
| InChIKey | JTFXLRDQYSVMIU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)O.C1=CC=C2C(=C1)C=C(N2)CN |
Computed by PubChem (NCBI)