CAS 62882-10-4 appears in our catalog under these names: 2-(2-Aminophenyl)oxazole, 95%, 2-(Oxazol-2-yl)aniline, 95%, 95%, 2-(OXAZOL-2-YL)ANILINE, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 50mg, 100mg.
2-(1,3-oxazol-2-yl)aniline (CAS 62882-10-4) is a chemical compound with the molecular formula C9H8N2O and a molecular weight of 160.17 g/mol. IUPAC name: 2-(1,3-oxazol-2-yl)aniline. InChIKey: QACOLYQTPFGDLC-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | 2-(1,3-oxazol-2-yl)aniline |
| InChIKey | QACOLYQTPFGDLC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC=CO2)N |
Computed by PubChem (NCBI)