CAS 56717-02-3 appears in our catalog under these names: 6-Aminoquinolin-4-ol, 95%, 6-Aminoquinolin-4-ol, 95+%, 6–Aminoquinolin–4–ol. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 5g, 10g, 1g, 100mg.
6-amino-1H-quinolin-4-one (CAS 56717-02-3) is a chemical compound with the molecular formula C9H8N2O and a molecular weight of 160.17 g/mol. IUPAC name: 6-amino-1H-quinolin-4-one. InChIKey: QDPTYTIUPLHNKB-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | 6-amino-1H-quinolin-4-one |
| InChIKey | QDPTYTIUPLHNKB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)C(=O)C=CN2 |
Computed by PubChem (NCBI)