CAS 1261529-03-6 appears in our catalog under these names: 5-Aminoquinolin-3-ol, 95%, 5-aminoquinolin-3-ol, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
5-aminoquinolin-3-ol (CAS 1261529-03-6) is a chemical compound with the molecular formula C9H8N2O and a molecular weight of 160.17 g/mol. IUPAC name: 5-aminoquinolin-3-ol. InChIKey: YMXQIJJAGDBYPH-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | 5-aminoquinolin-3-ol |
| InChIKey | YMXQIJJAGDBYPH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=C(C=NC2=C1)O)N |
Computed by PubChem (NCBI)