CAS 42712-64-1 appears in our catalog under these names: 2-Aminoquinolin-4-ol, 95%, 2-Amino-4-hydroxyquinoline hydrate, 97%, 2-Amino-4-hydroxyquinoline hydrate, 97%, water <12% , 2-Aminoquinolin-4-ol, 2-Aminoquinolin-4-ol, 95%, 95%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 2,5g, 100mg, 250mg, 25g, 2.5g.
2-amino-1H-quinolin-4-one (CAS 42712-64-1) is a chemical compound with the molecular formula C9H8N2O and a molecular weight of 160.17 g/mol. IUPAC name: 2-amino-1H-quinolin-4-one. InChIKey: LWGUCIXHBVVATR-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | 2-amino-1H-quinolin-4-one |
| InChIKey | LWGUCIXHBVVATR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C=C(N2)N |
Computed by PubChem (NCBI)