cas: 57882-27-6 — see every product listed under this CAS number, including other names
2-(Pyridin-2-yl)quinoline-4-carboxylic acid 95% (CAS 57882-27-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A100525-250mg |
| cas | 57882-27-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 259.12 Pln | |
| Ambeed | 5g | 859.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A100525 |
2-pyridin-2-ylquinoline-4-carboxylic acid (CAS 57882-27-6) is a chemical compound with the molecular formula C15H10N2O2 and a molecular weight of 250.25 g/mol. IUPAC name: 2-pyridin-2-ylquinoline-4-carboxylic acid. InChIKey: WSYCFYURDIXHNT-UHFFFAOYSA-N.
| Molecular formula | C15H10N2O2 |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | 2-pyridin-2-ylquinoline-4-carboxylic acid |
| InChIKey | WSYCFYURDIXHNT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=N2)C3=CC=CC=N3)C(=O)O |
Computed by PubChem (NCBI)