Products 849020-81-1
CAS 849020-81-1 appears in our catalog under these names: 2-Phenyl-1,6-naphthyridine-3-carboxylic acid, 95%, 2-Phenyl-1,6-naphthyridine-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 100mg.
2-phenyl-1,6-naphthyridine-3-carboxylic acid (CAS 849020-81-1) is a chemical compound with the molecular formula C15H10N2O2 and a molecular weight of 250.25 g/mol. IUPAC name: 2-phenyl-1,6-naphthyridine-3-carboxylic acid. InChIKey: JIFDGHZNEPJPIG-UHFFFAOYSA-N.
| Molecular formula | C15H10N2O2 |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | 2-phenyl-1,6-naphthyridine-3-carboxylic acid |
| InChIKey | JIFDGHZNEPJPIG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=C3C=NC=CC3=N2)C(=O)O |
Computed by PubChem (NCBI)