CAS 7672-01-7 appears in our catalog under these names: 2-Phenylquinazoline-4-carboxylic acid, 95%, 2–Phenylquinazoline–4–carboxylic acid, 2-Phenylquinazoline-4-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg.
2-phenylquinazoline-4-carboxylic acid (CAS 7672-01-7) is a chemical compound with the molecular formula C15H10N2O2 and a molecular weight of 250.25 g/mol. IUPAC name: 2-phenylquinazoline-4-carboxylic acid. InChIKey: JSVHXYUJLYICKV-UHFFFAOYSA-N.
| Molecular formula | C15H10N2O2 |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | 2-phenylquinazoline-4-carboxylic acid |
| InChIKey | JSVHXYUJLYICKV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=CC=CC=C3C(=N2)C(=O)O |
Computed by PubChem (NCBI)