CAS 10604-21-4 appears in our catalog under these names: 3-Phenylcinnoline-4-carboxylic acid, 3-Phenylcinnoline-4-carboxylic acid, 95%, 3-Phenylcinnoline-4-carboxylic acid, 97% . Offered by: Fluorochem, Combi-blocks, Thermo Scientific. Available pack sizes: 1g, 5g.
3-phenylcinnoline-4-carboxylic acid (CAS 10604-21-4) is a chemical compound with the molecular formula C15H10N2O2 and a molecular weight of 250.25 g/mol. IUPAC name: 3-phenylcinnoline-4-carboxylic acid. InChIKey: UGJHDXUWDLKCDG-UHFFFAOYSA-N.
| Molecular formula | C15H10N2O2 |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | 3-phenylcinnoline-4-carboxylic acid |
| InChIKey | UGJHDXUWDLKCDG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C3=CC=CC=C3N=N2)C(=O)O |
Computed by PubChem (NCBI)