cas: 177202-83-4 — see every product listed under this CAS number, including other names
2-(Pyridin-3-yl)aniline, 95% (CAS 177202-83-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F226529-250MG |
| cas | 177202-83-4 |
| size | 250mg |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 5g | 1825.42 Pln | |
| Fluorochem | 10g | 3543.56 Pln | |
| Fluorochem | 25g | 8604.28 Pln | |
| Ambeed | 100mg | 242.44 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 420.44 Pln | |
| Ambeed | 5g | 1811.06 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
2-pyridin-3-ylaniline (CAS 177202-83-4) is a chemical compound with the molecular formula C11H10N2 and a molecular weight of 170.21 g/mol. IUPAC name: 2-pyridin-3-ylaniline. InChIKey: MTYHJHATMPCNLW-UHFFFAOYSA-N.
| Molecular formula | C11H10N2 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | 2-pyridin-3-ylaniline |
| InChIKey | MTYHJHATMPCNLW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CN=CC=C2)N |
Computed by PubChem (NCBI)