CAS 60781-83-1 appears in our catalog under these names: 2-Amino-4-phenylpyridine, 97%, 4-Phenylpyridin-2-amine, 95%, 4–Phenyl–pyridin–2–ylamine, 2-Amino-4-phenylpyridine, 96%. Offered by: Combi-blocks, Chemat Brand, GLPBio, Fluorochem. Available pack sizes: 1g, 25g, 10g, 5g, 250mg, on request.
4-phenylpyridin-2-amine (CAS 60781-83-1) is a chemical compound with the molecular formula C11H10N2 and a molecular weight of 170.21 g/mol. IUPAC name: 4-phenylpyridin-2-amine. InChIKey: BAOIJCGWLQNKOE-UHFFFAOYSA-N.
| Molecular formula | C11H10N2 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | 4-phenylpyridin-2-amine |
| InChIKey | BAOIJCGWLQNKOE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC=C2)N |
Computed by PubChem (NCBI)