cas: 1256355-49-3 — see every product listed under this CAS number, including other names
2-(Pyridin-4-ylmethoxy)phenylboronic acid, 96%, 96% (CAS 1256355-49-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111O5A-100mg |
| cas | 1256355-49-3 |
| size | 100mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 371.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
[2-(pyridin-4-ylmethoxy)phenyl]boronic acid (CAS 1256355-49-3) is a chemical compound with the molecular formula C12H12BNO3 and a molecular weight of 229.04 g/mol. IUPAC name: [2-(pyridin-4-ylmethoxy)phenyl]boronic acid. InChIKey: KMRAOKJLIHHQJB-UHFFFAOYSA-N.
| Molecular formula | C12H12BNO3 |
|---|---|
| Molecular weight | 229.04 g/mol |
| IUPAC name | [2-(pyridin-4-ylmethoxy)phenyl]boronic acid |
| InChIKey | KMRAOKJLIHHQJB-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1OCC2=CC=NC=C2)(O)O |
Computed by PubChem (NCBI)