cas: 60479-64-3 — see every product listed under this CAS number, including other names
2-(R)-Dibenzylaminopropan-1-ol 95% (CAS 60479-64-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A654776-250mg |
| cas | 60479-64-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 804.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A654776 |
(2R)-2-(dibenzylamino)propan-1-ol (CAS 60479-64-3) is a chemical compound with the molecular formula C17H21NO and a molecular weight of 255.35 g/mol. IUPAC name: (2R)-2-(dibenzylamino)propan-1-ol. InChIKey: IEEFFKXJADVWJO-OAHLLOKOSA-N.
| Molecular formula | C17H21NO |
|---|---|
| Molecular weight | 255.35 g/mol |
| IUPAC name | (2R)-2-(dibenzylamino)propan-1-ol |
| InChIKey | IEEFFKXJADVWJO-OAHLLOKOSA-N |
| SMILES | C[C@H](CO)N(CC1=CC=CC=C1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)