cas: 24070-16-4 — see every product listed under this CAS number, including other names
2-(TRITYL-AMINO)-ETHANOL, 97%, 97% (CAS 24070-16-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I5N2-100mg |
| cas | 24070-16-4 |
| size | 100mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 424.40 Pln | |
| Chemat | 250mg | 664.40 Pln | |
| Chemat | 1g | 1566.80 Pln | |
| Chemat | 5g | 4571.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(tritylamino)ethanol (CAS 24070-16-4) is a chemical compound with the molecular formula C21H21NO and a molecular weight of 303.4 g/mol. IUPAC name: 2-(tritylamino)ethanol. InChIKey: GHSBJDZSBNDAGL-UHFFFAOYSA-N.
| Molecular formula | C21H21NO |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | 2-(tritylamino)ethanol |
| InChIKey | GHSBJDZSBNDAGL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)NCCO |
Computed by PubChem (NCBI)