cas: 24070-16-4 — see every product listed under this CAS number, including other names
2-(TRITYL-AMINO)-ETHANOL, 97% (CAS 24070-16-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F468824-250MG |
| cas | 24070-16-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 383.22 Pln | |
| Fluorochem | 1g | 700.81 Pln | |
| Fluorochem | 5g | 2361.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(tritylamino)ethanol (CAS 24070-16-4) is a chemical compound with the molecular formula C21H21NO and a molecular weight of 303.4 g/mol. IUPAC name: 2-(tritylamino)ethanol. InChIKey: GHSBJDZSBNDAGL-UHFFFAOYSA-N.
| Molecular formula | C21H21NO |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | 2-(tritylamino)ethanol |
| InChIKey | GHSBJDZSBNDAGL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)NCCO |
Computed by PubChem (NCBI)