cas: 3038-47-9 — see every product listed under this CAS number, including other names
2-(Trifluoromethyl)phenylacetonitrile 99+% (CAS 3038-47-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1475835-25g |
| cas | 3038-47-9 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 314.75 Pln | |
| Ambeed | 100g | 882.12 Pln |
| purity | 99+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1475835 |
2-[2-(trifluoromethyl)phenyl]acetonitrile (CAS 3038-47-9) is a chemical compound with the molecular formula C9H6F3N and a molecular weight of 185.15 g/mol. IUPAC name: 2-[2-(trifluoromethyl)phenyl]acetonitrile. InChIKey: QXDCZSJGEUSERL-UHFFFAOYSA-N.
| Molecular formula | C9H6F3N |
|---|---|
| Molecular weight | 185.15 g/mol |
| IUPAC name | 2-[2-(trifluoromethyl)phenyl]acetonitrile |
| InChIKey | QXDCZSJGEUSERL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC#N)C(F)(F)F |
Computed by PubChem (NCBI)