cas: 3038-47-9 — see every product listed under this CAS number, including other names
2-(Trifluoromethyl)phenylacetonitrile (CAS 3038-47-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F007635-1G |
| cas | 3038-47-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 164.54 Pln | |
| Fluorochem | 25g | 351.98 Pln | |
| Fluorochem | 100g | 1252.70 Pln |
| delivery time | 2-3 weeks |
|---|
2-[2-(trifluoromethyl)phenyl]acetonitrile (CAS 3038-47-9) is a chemical compound with the molecular formula C9H6F3N and a molecular weight of 185.15 g/mol. IUPAC name: 2-[2-(trifluoromethyl)phenyl]acetonitrile. InChIKey: QXDCZSJGEUSERL-UHFFFAOYSA-N.
| Molecular formula | C9H6F3N |
|---|---|
| Molecular weight | 185.15 g/mol |
| IUPAC name | 2-[2-(trifluoromethyl)phenyl]acetonitrile |
| InChIKey | QXDCZSJGEUSERL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC#N)C(F)(F)F |
Computed by PubChem (NCBI)