Products 1189713-18-5
CAS 1189713-18-5 appears in our catalog under these names: Memantine-d6 HCl, Memantine-d6 Hydrochloride, >95% (HPLC), Memantine–d6 (hydrochloride), rac-(3S,5S)-3,5-Bis(trideuteriomethyl)adamantan-1-amine hydrochloride, Memantine-d6 (hydrochloride), 99.83%. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 500μg, 2mg, 5mg, 500 μg, 1 mg.
(3R,5S)-3,5-bis(trideuteriomethyl)adamantan-1-amine;hydrochloride (CAS 1189713-18-5) is a chemical compound with the molecular formula C12H22ClN and a molecular weight of 221.80 g/mol. IUPAC name: (3R,5S)-3,5-bis(trideuteriomethyl)adamantan-1-amine;hydrochloride. InChIKey: LDDHMLJTFXJGPI-XJAKYWJYSA-N.
| Molecular formula | C12H22ClN |
|---|---|
| Molecular weight | 221.80 g/mol |
| IUPAC name | (3R,5S)-3,5-bis(trideuteriomethyl)adamantan-1-amine;hydrochloride |
| InChIKey | LDDHMLJTFXJGPI-XJAKYWJYSA-N |
| SMILES | [2H]C([2H])([2H])[C@]12CC3C[C@](C1)(CC(C3)(C2)N)C([2H])([2H])[2H].Cl |
Computed by PubChem (NCBI)