CAS 1005341-54-7 appears in our catalog under these names: (S)-1-(Adamantan-1-yl)ethan-1-amine hydrochloride, 97%, (1S)–1–(Adamantan–1–yl)ethan–1–amine hydrochloride, (1S)-1-(Adamantan-1-yl)ethan-1-amine hydrochloride. Offered by: Chemat Brand, GLPBio, Biosynth. Available pack sizes: on request, 100mg, 250mg, 2,5g.
(1S)-1-(1-adamantyl)ethanamine;hydrochloride (CAS 1005341-54-7) is a chemical compound with the molecular formula C12H22ClN and a molecular weight of 215.76 g/mol. IUPAC name: (1S)-1-(1-adamantyl)ethanamine;hydrochloride. InChIKey: OZBDFBJXRJWNAV-CPYWBCLGSA-N.
| Molecular formula | C12H22ClN |
|---|---|
| Molecular weight | 215.76 g/mol |
| IUPAC name | (1S)-1-(1-adamantyl)ethanamine;hydrochloride |
| InChIKey | OZBDFBJXRJWNAV-CPYWBCLGSA-N |
| SMILES | C[C@@H](C12CC3CC(C1)CC(C3)C2)N.Cl |
Computed by PubChem (NCBI)