cas: 632-24-6 — see every product listed under this CAS number, including other names
2-(aminosulfonyl)benzoic acid, 97% (CAS 632-24-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F875111-250MG |
| cas | 632-24-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 445.69 Pln | |
| Fluorochem | 1g | 1606.74 Pln | |
| Fluorochem | 5g | 5839.63 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-sulfamoylbenzoic acid (CAS 632-24-6) is a chemical compound with the molecular formula C7H7NO4S and a molecular weight of 201.20 g/mol. IUPAC name: 2-sulfamoylbenzoic acid. InChIKey: KDNIOKSLVIGAAN-UHFFFAOYSA-N.
| Molecular formula | C7H7NO4S |
|---|---|
| Molecular weight | 201.20 g/mol |
| IUPAC name | 2-sulfamoylbenzoic acid |
| InChIKey | KDNIOKSLVIGAAN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)S(=O)(=O)N |
Computed by PubChem (NCBI)