CAS 1186663-34-2 appears in our catalog under these names: 6-(Methylsulfonyl)nicotinic acid, 98%, 6–(Methylsulfonyl)nicotinic Acid, 6-(Methylsulfonyl)nicotinic acid, 6-(Methylsulfonyl)nicotinic Acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 2,5g, 100mg, 250mg.
6-methylsulfonylpyridine-3-carboxylic acid (CAS 1186663-34-2) is a chemical compound with the molecular formula C7H7NO4S and a molecular weight of 201.20 g/mol. IUPAC name: 6-methylsulfonylpyridine-3-carboxylic acid. InChIKey: VXELRDIIZXYOMH-UHFFFAOYSA-N.
| Molecular formula | C7H7NO4S |
|---|---|
| Molecular weight | 201.20 g/mol |
| IUPAC name | 6-methylsulfonylpyridine-3-carboxylic acid |
| InChIKey | VXELRDIIZXYOMH-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=NC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)