CAS 636-76-0 appears in our catalog under these names: 3–Sulfamoylbenzoic acid, Benzoic acid, 3-(aminosulfonyl)-, 98%, 98%, 3-Sulfamoyl-benzoic acid, 95%, 3-Sulfamoylbenzoic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 50g, 100g.
3-sulfamoylbenzoic acid (CAS 636-76-0) is a chemical compound with the molecular formula C7H7NO4S and a molecular weight of 201.20 g/mol. IUPAC name: 3-sulfamoylbenzoic acid. InChIKey: NAETXYOXMDYNLE-UHFFFAOYSA-N.
| Molecular formula | C7H7NO4S |
|---|---|
| Molecular weight | 201.20 g/mol |
| IUPAC name | 3-sulfamoylbenzoic acid |
| InChIKey | NAETXYOXMDYNLE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)N)C(=O)O |
Computed by PubChem (NCBI)