cas: 6528-83-2 — see every product listed under this CAS number, including other names
2-(m-Tolyl)-1H-benzo[d]imidazole, 97%, 97% (CAS 6528-83-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E9QB-1g |
| cas | 6528-83-2 |
| size | 1g |
| availability | 55g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2046.80 Pln | |
| Chemat | 5g | 8080.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(3-methylphenyl)-1H-benzimidazole (CAS 6528-83-2) is a chemical compound with the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. IUPAC name: 2-(3-methylphenyl)-1H-benzimidazole. InChIKey: USLJYASOSQJYGN-UHFFFAOYSA-N.
| Molecular formula | C14H12N2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | 2-(3-methylphenyl)-1H-benzimidazole |
| InChIKey | USLJYASOSQJYGN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=NC3=CC=CC=C3N2 |
Computed by PubChem (NCBI)