CAS 6052-15-9 appears in our catalog under these names: 4-[2-(4-Aminophenyl)ethynyl]aniline, 95%, 4,4'–(Ethyne–1,2–diyl)dianiline, 4,4'-(Ethyne-1,2-diyl)dianiline 95%, 4,4'-(Ethyne-1,2-diyl)dianiline, 95%, 95%, 4,4'-(Ethyne-1,2-diyl)dianiline, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g, 25g.
4-[2-(4-aminophenyl)ethynyl]aniline (CAS 6052-15-9) is a chemical compound with the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. IUPAC name: 4-[2-(4-aminophenyl)ethynyl]aniline. InChIKey: WAUKJWLKPXRNKT-UHFFFAOYSA-N.
| Molecular formula | C14H12N2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | 4-[2-(4-aminophenyl)ethynyl]aniline |
| InChIKey | WAUKJWLKPXRNKT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#CC2=CC=C(C=C2)N)N |
Computed by PubChem (NCBI)