CAS 34658-68-9 appears in our catalog under these names: 3-Methyl-2-phenylimidazo[1,2-a]pyridine, 95%, 3-Methyl-2-phenylimidazo(1,2-a)pyridine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
3-methyl-2-phenylimidazo[1,2-a]pyridine (CAS 34658-68-9) is a chemical compound with the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. IUPAC name: 3-methyl-2-phenylimidazo[1,2-a]pyridine. InChIKey: XWCGFQPHUYFTPC-UHFFFAOYSA-N.
| Molecular formula | C14H12N2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | 3-methyl-2-phenylimidazo[1,2-a]pyridine |
| InChIKey | XWCGFQPHUYFTPC-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C2N1C=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)