CAS 46710-42-3 appears in our catalog under these names: Anthracene-2,6-diamine, 95%, Anthracene–2,6–diamine, Anthracene-2,6-diamine 97%, 2,6-Anthracenediamine, 97%, 97%, Anthracene-2,6-diamine, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 100mg, 1g, 10g.
Anthracene-2,6-diamine (CAS 46710-42-3) is a chemical compound with the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. IUPAC name: anthracene-2,6-diamine. InChIKey: UXOSWMZHKZFJHD-UHFFFAOYSA-N.
| Molecular formula | C14H12N2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | anthracene-2,6-diamine |
| InChIKey | UXOSWMZHKZFJHD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=CC3=C(C=C21)C=C(C=C3)N)N |
Computed by PubChem (NCBI)